About 1-oxidoquinoxalin-1-ium
1-oxidoquinoxalin-1-ium (PubChem CID 23363) has the molecular formula C8H6N2O
and a molecular weight of 146.15 g/mol. Its IUPAC name is 1-oxidoquinoxalin-1-ium.
Molecular Properties
| Compound Name | 1-oxidoquinoxalin-1-ium |
| PubChem CID | 23363 |
| Molecular Formula | C8H6N2O |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | 1-oxidoquinoxalin-1-ium |
| SMILES | [O-][n+]1ccnc2ccccc21 |
| InChI | InChI=1S/C8H6N2O/c11-10-6-5-9-7-3-1-2-4-8(7)10/h1-6H |
| InChIKey | OARGFWQSVACNCO-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 39.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-oxidoquinoxalin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxidoquinoxalin-1-ium?
The IUPAC name of 1-oxidoquinoxalin-1-ium (CID 23363) is 1-oxidoquinoxalin-1-ium.
What is the SMILES notation for 1-oxidoquinoxalin-1-ium?
The canonical SMILES for 1-oxidoquinoxalin-1-ium is [O-][n+]1ccnc2ccccc21.
What is the InChIKey of 1-oxidoquinoxalin-1-ium?
The InChIKey is OARGFWQSVACNCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O/c11-10-6-5-9-7-3-1-2-4-8(7)10/h1-6H.
What are the key properties of 1-oxidoquinoxalin-1-ium?
1-oxidoquinoxalin-1-ium has a molecular weight of 146.15 g/mol, XLogP of 0.87, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxidoquinoxalin-1-ium is sourced from PubChem (CID 23363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).