About 1H-pyrano[4,3-b]indol-3-one
1H-pyrano[4,3-b]indol-3-one (PubChem CID 23363345) has the molecular formula C11H7NO2
and a molecular weight of 185.18 g/mol. Its IUPAC name is 1H-pyrano[4,3-b]indol-3-one.
Molecular Properties
| Compound Name | 1H-pyrano[4,3-b]indol-3-one |
| PubChem CID | 23363345 |
| Molecular Formula | C11H7NO2 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | 1H-pyrano[4,3-b]indol-3-one |
| SMILES | O=C1C=C2N=c3ccccc3=C2CO1 |
| InChI | InChI=1S/C11H7NO2/c13-11-5-10-8(6-14-11)7-3-1-2-4-9(7)12-10/h1-5H,6H2 |
| InChIKey | QTDBDEURGDDWSM-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-pyrano[4,3-b]indol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrano[4,3-b]indol-3-one?
The IUPAC name of 1H-pyrano[4,3-b]indol-3-one (CID 23363345) is 1H-pyrano[4,3-b]indol-3-one.
What is the SMILES notation for 1H-pyrano[4,3-b]indol-3-one?
The canonical SMILES for 1H-pyrano[4,3-b]indol-3-one is O=C1C=C2N=c3ccccc3=C2CO1.
What is the InChIKey of 1H-pyrano[4,3-b]indol-3-one?
The InChIKey is QTDBDEURGDDWSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7NO2/c13-11-5-10-8(6-14-11)7-3-1-2-4-9(7)12-10/h1-5H,6H2.
What are the key properties of 1H-pyrano[4,3-b]indol-3-one?
1H-pyrano[4,3-b]indol-3-one has a molecular weight of 185.18 g/mol, XLogP of -0.09, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrano[4,3-b]indol-3-one is sourced from PubChem (CID 23363345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).