About 2-hydroxy-4,7-dipropylisoindole-1,3-diimine
2-hydroxy-4,7-dipropylisoindole-1,3-diimine (PubChem CID 23363508) has the molecular formula C14H19N3O
and a molecular weight of 245.33 g/mol. Its IUPAC name is 2-hydroxy-4,7-dipropylisoindole-1,3-diimine.
Molecular Properties
| Compound Name | 2-hydroxy-4,7-dipropylisoindole-1,3-diimine |
| PubChem CID | 23363508 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 2-hydroxy-4,7-dipropylisoindole-1,3-diimine |
| SMILES | [H]/N=C1/c2c(CCC)ccc(CCC)c2/C(=N/[H])N1O |
| InChI | InChI=1S/C14H19N3O/c1-3-5-9-7-8-10(6-4-2)12-11(9)13(15)17(18)14(12)16/h7-8,15-16,18H,3-6H2,1-2H3/b15-13-,16-14- |
| InChIKey | UNJLXXNFDYHOQE-VMNXYWKNSA-N |
| XLogP | 2.95 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-4,7-dipropylisoindole-1,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-4,7-dipropylisoindole-1,3-diimine?
The IUPAC name of 2-hydroxy-4,7-dipropylisoindole-1,3-diimine (CID 23363508) is 2-hydroxy-4,7-dipropylisoindole-1,3-diimine.
What is the SMILES notation for 2-hydroxy-4,7-dipropylisoindole-1,3-diimine?
The canonical SMILES for 2-hydroxy-4,7-dipropylisoindole-1,3-diimine is [H]/N=C1/c2c(CCC)ccc(CCC)c2/C(=N/[H])N1O.
What is the InChIKey of 2-hydroxy-4,7-dipropylisoindole-1,3-diimine?
The InChIKey is UNJLXXNFDYHOQE-VMNXYWKNSA-N. The full InChI is InChI=1S/C14H19N3O/c1-3-5-9-7-8-10(6-4-2)12-11(9)13(15)17(18)14(12)16/h7-8,15-16,18H,3-6H2,1-2H3/b15-13-,16-14-.
What are the key properties of 2-hydroxy-4,7-dipropylisoindole-1,3-diimine?
2-hydroxy-4,7-dipropylisoindole-1,3-diimine has a molecular weight of 245.33 g/mol, XLogP of 2.95, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-4,7-dipropylisoindole-1,3-diimine is sourced from PubChem (CID 23363508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).