C21H25N3O6S2 — CID 2336359
(E)-3-(4-morpholin-4-ylsulfonylphenyl)-N-[2-(4-sulfamoylphenyl)ethyl]prop-2-enamide (PubChem CID 2336359) has the molecular formula C21H25N3O6S2 and a molecular weight of 479.60 g/mol. Its IUPAC name is (E)-3-(4-morpholin-4-ylsulfonylphenyl)-N-[2-(4-sulfamoylphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(4-morpholin-4-ylsulfonylphenyl)-N-[2-(4-sulfamoylphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 2336359 |
| Molecular Formula | C21H25N3O6S2 |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | (E)-3-(4-morpholin-4-ylsulfonylphenyl)-N-[2-(4-sulfamoylphenyl)ethyl]prop-2-enamide |
| SMILES | C1COCCN1S(=O)(=O)C2=CC=C(C=C2)/C=C/C(=O)NCCC3=CC=C(C=C3)S(=O)(=O)N |
| InChI | InChI=1S/C21H25N3O6S2/c22-31(26,27)19-6-1-18(2-7-19)11-12-23-21(25)10-5-17-3-8-20(9-4-17)32(28,29)24-13-15-30-16-14-24/h1-10H,11-16H2,(H,23,25)(H2,22,26,27)/b10-5+ |
| InChIKey | NQQSWRNTQZUDNN-BJMVGYQFSA-N |
| XLogP | 0.90 |
| TPSA | 153.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | 841 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|