About 4-phenylnonane-2-thione
4-phenylnonane-2-thione (PubChem CID 23365648) has the molecular formula C15H22S
and a molecular weight of 234.41 g/mol. Its IUPAC name is 4-phenylnonane-2-thione.
Molecular Properties
| Compound Name | 4-phenylnonane-2-thione |
| PubChem CID | 23365648 |
| Molecular Formula | C15H22S |
| Molecular Weight | 234.41 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 4-phenylnonane-2-thione |
| SMILES | CCCCCC(CC(C)=S)c1ccccc1 |
| InChI | InChI=1S/C15H22S/c1-3-4-6-11-15(12-13(2)16)14-9-7-5-8-10-14/h5,7-10,15H,3-4,6,11-12H2,1-2H3 |
| InChIKey | MXIDAQXCSOATOX-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 234.41 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-phenylnonane-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylnonane-2-thione?
The IUPAC name of 4-phenylnonane-2-thione (CID 23365648) is 4-phenylnonane-2-thione.
What is the SMILES notation for 4-phenylnonane-2-thione?
The canonical SMILES for 4-phenylnonane-2-thione is CCCCCC(CC(C)=S)c1ccccc1.
What is the InChIKey of 4-phenylnonane-2-thione?
The InChIKey is MXIDAQXCSOATOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22S/c1-3-4-6-11-15(12-13(2)16)14-9-7-5-8-10-14/h5,7-10,15H,3-4,6,11-12H2,1-2H3.
What are the key properties of 4-phenylnonane-2-thione?
4-phenylnonane-2-thione has a molecular weight of 234.41 g/mol, XLogP of 5.13, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylnonane-2-thione is sourced from PubChem (CID 23365648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).