About O-(3-aminopropyl) 4-(dimethylamino)butanethioate
O-(3-aminopropyl) 4-(dimethylamino)butanethioate (PubChem CID 23366299) has the molecular formula C9H20N2OS
and a molecular weight of 204.34 g/mol. Its IUPAC name is O-(3-aminopropyl) 4-(dimethylamino)butanethioate.
Molecular Properties
| Compound Name | O-(3-aminopropyl) 4-(dimethylamino)butanethioate |
| PubChem CID | 23366299 |
| Molecular Formula | C9H20N2OS |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | O-(3-aminopropyl) 4-(dimethylamino)butanethioate |
| SMILES | CN(C)CCCC(=S)OCCCN |
| InChI | InChI=1S/C9H20N2OS/c1-11(2)7-3-5-9(13)12-8-4-6-10/h3-8,10H2,1-2H3 |
| InChIKey | YJSYMQGPYHDESI-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(3-aminopropyl) 4-(dimethylamino)butanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(3-aminopropyl) 4-(dimethylamino)butanethioate?
The IUPAC name of O-(3-aminopropyl) 4-(dimethylamino)butanethioate (CID 23366299) is O-(3-aminopropyl) 4-(dimethylamino)butanethioate.
What is the SMILES notation for O-(3-aminopropyl) 4-(dimethylamino)butanethioate?
The canonical SMILES for O-(3-aminopropyl) 4-(dimethylamino)butanethioate is CN(C)CCCC(=S)OCCCN.
What is the InChIKey of O-(3-aminopropyl) 4-(dimethylamino)butanethioate?
The InChIKey is YJSYMQGPYHDESI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2OS/c1-11(2)7-3-5-9(13)12-8-4-6-10/h3-8,10H2,1-2H3.
What are the key properties of O-(3-aminopropyl) 4-(dimethylamino)butanethioate?
O-(3-aminopropyl) 4-(dimethylamino)butanethioate has a molecular weight of 204.34 g/mol, XLogP of 1.02, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-(3-aminopropyl) 4-(dimethylamino)butanethioate is sourced from PubChem (CID 23366299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).