About disodium;2-decyl-3-(2-decyl-3-sulfonatophenoxy)benzenesulfonate
disodium;2-decyl-3-(2-decyl-3-sulfonatophenoxy)benzenesulfonate (PubChem CID 23366630) has the molecular formula C32H48Na2O7S2
and a molecular weight of 654.84 g/mol. Its IUPAC name is disodium;2-decyl-3-(2-decyl-3-sulfonatophenoxy)benzenesulfonate.
Molecular Properties
| Compound Name | disodium;2-decyl-3-(2-decyl-3-sulfonatophenoxy)benzenesulfonate |
| PubChem CID | 23366630 |
| Molecular Formula | C32H48Na2O7S2 |
| Molecular Weight | 654.84 g/mol |
| Exact Mass | 654.26 |
| IUPAC Name | disodium;2-decyl-3-(2-decyl-3-sulfonatophenoxy)benzenesulfonate |
| SMILES | CCCCCCCCCCc1c(Oc2cccc(S(=O)(=O)[O-])c2CCCCCCCCCC)cccc1S(=O)(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C32H50O7S2.2Na/c1-3-5-7-9-11-13-15-17-21-27-29(23-19-25-31(27)40(33,34)35)39-30-24-20-26-32(41(36,37)38)28(30)22-18-16-14-12-10-8-6-4-2;;/h19-20,23-26H,3-18,21-22H2,1-2H3,(H,33,34,35)(H,36,37,38);;/q;2*+1/p-2 |
| InChIKey | YEQDPGNXYXJTLM-UHFFFAOYSA-L |
| XLogP | 2.66 |
| TPSA | 123.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 654.84 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze disodium;2-decyl-3-(2-decyl-3-sulfonatophenoxy)benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;2-decyl-3-(2-decyl-3-sulfonatophenoxy)benzenesulfonate?
The IUPAC name of disodium;2-decyl-3-(2-decyl-3-sulfonatophenoxy)benzenesulfonate (CID 23366630) is disodium;2-decyl-3-(2-decyl-3-sulfonatophenoxy)benzenesulfonate.
What is the SMILES notation for disodium;2-decyl-3-(2-decyl-3-sulfonatophenoxy)benzenesulfonate?
The canonical SMILES for disodium;2-decyl-3-(2-decyl-3-sulfonatophenoxy)benzenesulfonate is CCCCCCCCCCc1c(Oc2cccc(S(=O)(=O)[O-])c2CCCCCCCCCC)cccc1S(=O)(=O)[O-].[Na+].[Na+].
What is the InChIKey of disodium;2-decyl-3-(2-decyl-3-sulfonatophenoxy)benzenesulfonate?
The InChIKey is YEQDPGNXYXJTLM-UHFFFAOYSA-L. The full InChI is InChI=1S/C32H50O7S2.2Na/c1-3-5-7-9-11-13-15-17-21-27-29(23-19-25-31(27)40(33,34)35)39-30-24-20-26-32(41(36,37)38)28(30)22-18-16-14-12-10-8-6-4-2;;/h19-20,23-26H,3-18,21-22H2,1-2H3,(H,33,34,35)(H,36,37,38);;/q;2*+1/p-2.
What are the key properties of disodium;2-decyl-3-(2-decyl-3-sulfonatophenoxy)benzenesulfonate?
disodium;2-decyl-3-(2-decyl-3-sulfonatophenoxy)benzenesulfonate has a molecular weight of 654.84 g/mol, XLogP of 2.66, 22 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;2-decyl-3-(2-decyl-3-sulfonatophenoxy)benzenesulfonate is sourced from PubChem (CID 23366630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).