About 4-N-(1H-indol-5-yl)quinazoline-4,6-diamine
4-N-(1H-indol-5-yl)quinazoline-4,6-diamine (PubChem CID 23366728) has the molecular formula C16H13N5
and a molecular weight of 275.31 g/mol. Its IUPAC name is 4-N-(1H-indol-5-yl)quinazoline-4,6-diamine.
Molecular Properties
| Compound Name | 4-N-(1H-indol-5-yl)quinazoline-4,6-diamine |
| PubChem CID | 23366728 |
| Molecular Formula | C16H13N5 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 4-N-(1H-indol-5-yl)quinazoline-4,6-diamine |
| SMILES | Nc1ccc2ncnc(Nc3ccc4[nH]ccc4c3)c2c1 |
| InChI | InChI=1S/C16H13N5/c17-11-1-3-15-13(8-11)16(20-9-19-15)21-12-2-4-14-10(7-12)5-6-18-14/h1-9,18H,17H2,(H,19,20,21) |
| InChIKey | CERWMQWGUSIWNF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-N-(1H-indol-5-yl)quinazoline-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(1H-indol-5-yl)quinazoline-4,6-diamine?
The IUPAC name of 4-N-(1H-indol-5-yl)quinazoline-4,6-diamine (CID 23366728) is 4-N-(1H-indol-5-yl)quinazoline-4,6-diamine.
What is the SMILES notation for 4-N-(1H-indol-5-yl)quinazoline-4,6-diamine?
The canonical SMILES for 4-N-(1H-indol-5-yl)quinazoline-4,6-diamine is Nc1ccc2ncnc(Nc3ccc4[nH]ccc4c3)c2c1.
What is the InChIKey of 4-N-(1H-indol-5-yl)quinazoline-4,6-diamine?
The InChIKey is CERWMQWGUSIWNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N5/c17-11-1-3-15-13(8-11)16(20-9-19-15)21-12-2-4-14-10(7-12)5-6-18-14/h1-9,18H,17H2,(H,19,20,21).
What are the key properties of 4-N-(1H-indol-5-yl)quinazoline-4,6-diamine?
4-N-(1H-indol-5-yl)quinazoline-4,6-diamine has a molecular weight of 275.31 g/mol, XLogP of 3.44, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(1H-indol-5-yl)quinazoline-4,6-diamine is sourced from PubChem (CID 23366728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).