About (3,4-dimethylphenyl)methyl N-[2-(4-fluorophenyl)ethyl]carbamate
(3,4-dimethylphenyl)methyl N-[2-(4-fluorophenyl)ethyl]carbamate (PubChem CID 23366832) has the molecular formula C18H20FNO2
and a molecular weight of 301.36 g/mol. Its IUPAC name is (3,4-dimethylphenyl)methyl N-[2-(4-fluorophenyl)ethyl]carbamate.
Molecular Properties
| Compound Name | (3,4-dimethylphenyl)methyl N-[2-(4-fluorophenyl)ethyl]carbamate |
| PubChem CID | 23366832 |
| Molecular Formula | C18H20FNO2 |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | (3,4-dimethylphenyl)methyl N-[2-(4-fluorophenyl)ethyl]carbamate |
| SMILES | Cc1ccc(COC(=O)NCCc2ccc(F)cc2)cc1C |
| InChI | InChI=1S/C18H20FNO2/c1-13-3-4-16(11-14(13)2)12-22-18(21)20-10-9-15-5-7-17(19)8-6-15/h3-8,11H,9-10,12H2,1-2H3,(H,20,21) |
| InChIKey | OULGGRXLCJCSST-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3,4-dimethylphenyl)methyl N-[2-(4-fluorophenyl)ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dimethylphenyl)methyl N-[2-(4-fluorophenyl)ethyl]carbamate?
The IUPAC name of (3,4-dimethylphenyl)methyl N-[2-(4-fluorophenyl)ethyl]carbamate (CID 23366832) is (3,4-dimethylphenyl)methyl N-[2-(4-fluorophenyl)ethyl]carbamate.
What is the SMILES notation for (3,4-dimethylphenyl)methyl N-[2-(4-fluorophenyl)ethyl]carbamate?
The canonical SMILES for (3,4-dimethylphenyl)methyl N-[2-(4-fluorophenyl)ethyl]carbamate is Cc1ccc(COC(=O)NCCc2ccc(F)cc2)cc1C.
What is the InChIKey of (3,4-dimethylphenyl)methyl N-[2-(4-fluorophenyl)ethyl]carbamate?
The InChIKey is OULGGRXLCJCSST-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20FNO2/c1-13-3-4-16(11-14(13)2)12-22-18(21)20-10-9-15-5-7-17(19)8-6-15/h3-8,11H,9-10,12H2,1-2H3,(H,20,21).
What are the key properties of (3,4-dimethylphenyl)methyl N-[2-(4-fluorophenyl)ethyl]carbamate?
(3,4-dimethylphenyl)methyl N-[2-(4-fluorophenyl)ethyl]carbamate has a molecular weight of 301.36 g/mol, XLogP of 3.91, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dimethylphenyl)methyl N-[2-(4-fluorophenyl)ethyl]carbamate is sourced from PubChem (CID 23366832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).