C22H31N5O2 — CID 23368044
2-[4-[4-(6-methoxy-2-pyridinyl)piperazin-1-yl]butoxy]-5,6,7,8-tetrahydroquinoxaline (PubChem CID 23368044) has the molecular formula C22H31N5O2 and a molecular weight of 397.52 g/mol. Its IUPAC name is 2-[4-[4-(6-methoxy-2-pyridinyl)piperazin-1-yl]butoxy]-5,6,7,8-tetrahydroquinoxaline.
| Compound Name | 2-[4-[4-(6-methoxy-2-pyridinyl)piperazin-1-yl]butoxy]-5,6,7,8-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 23368044 |
| Molecular Formula | C22H31N5O2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | 2-[4-[4-(6-methoxy-2-pyridinyl)piperazin-1-yl]butoxy]-5,6,7,8-tetrahydroquinoxaline |
| SMILES | COc1cccc(N2CCN(CCCCOc3cnc4c(n3)CCCC4)CC2)n1 |
| InChI | InChI=1S/C22H31N5O2/c1-28-21-10-6-9-20(25-21)27-14-12-26(13-15-27)11-4-5-16-29-22-17-23-18-7-2-3-8-19(18)24-22/h6,9-10,17H,2-5,7-8,11-16H2,1H3 |
| InChIKey | YFKDNJIBFHCXIX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 63.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|