C6H12N6O — CID 23368067
3-hydroxy-6-propylimino-1,3,5-triazine-2,4-diamine (PubChem CID 23368067) has the molecular formula C6H12N6O and a molecular weight of 184.20 g/mol. Its IUPAC name is 3-hydroxy-6-propylimino-1,3,5-triazine-2,4-diamine.
| Compound Name | 3-hydroxy-6-propylimino-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 23368067 |
| Molecular Formula | C6H12N6O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 3-hydroxy-6-propylimino-1,3,5-triazine-2,4-diamine |
| SMILES | CCCN=c1nc(N)n(O)c(N)n1 |
| InChI | InChI=1S/C6H12N6O/c1-2-3-9-6-10-4(7)12(13)5(8)11-6/h13H,2-3H2,1H3,(H4,7,8,9,10,11) |
| InChIKey | QWSILVAKQPATTR-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 115.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|