About [3-amino-4-[(5-chloro-1,2-benzoxazol-3-yl)oxy]butyl] carbamate;hydrochloride
[3-amino-4-[(5-chloro-1,2-benzoxazol-3-yl)oxy]butyl] carbamate;hydrochloride (PubChem CID 23368426) has the molecular formula C12H15Cl2N3O4
and a molecular weight of 336.18 g/mol. Its IUPAC name is [3-amino-4-[(5-chloro-1,2-benzoxazol-3-yl)oxy]butyl] carbamate;hydrochloride.
Molecular Properties
| Compound Name | [3-amino-4-[(5-chloro-1,2-benzoxazol-3-yl)oxy]butyl] carbamate;hydrochloride |
| PubChem CID | 23368426 |
| Molecular Formula | C12H15Cl2N3O4 |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | [3-amino-4-[(5-chloro-1,2-benzoxazol-3-yl)oxy]butyl] carbamate;hydrochloride |
| SMILES | Cl.NC(=O)OCCC(N)COc1noc2ccc(Cl)cc12 |
| InChI | InChI=1S/C12H14ClN3O4.ClH/c13-7-1-2-10-9(5-7)11(16-20-10)19-6-8(14)3-4-18-12(15)17;/h1-2,5,8H,3-4,6,14H2,(H2,15,17);1H |
| InChIKey | YZZVCLAGBLPBGQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-amino-4-[(5-chloro-1,2-benzoxazol-3-yl)oxy]butyl] carbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-amino-4-[(5-chloro-1,2-benzoxazol-3-yl)oxy]butyl] carbamate;hydrochloride?
The IUPAC name of [3-amino-4-[(5-chloro-1,2-benzoxazol-3-yl)oxy]butyl] carbamate;hydrochloride (CID 23368426) is [3-amino-4-[(5-chloro-1,2-benzoxazol-3-yl)oxy]butyl] carbamate;hydrochloride.
What is the SMILES notation for [3-amino-4-[(5-chloro-1,2-benzoxazol-3-yl)oxy]butyl] carbamate;hydrochloride?
The canonical SMILES for [3-amino-4-[(5-chloro-1,2-benzoxazol-3-yl)oxy]butyl] carbamate;hydrochloride is Cl.NC(=O)OCCC(N)COc1noc2ccc(Cl)cc12.
What is the InChIKey of [3-amino-4-[(5-chloro-1,2-benzoxazol-3-yl)oxy]butyl] carbamate;hydrochloride?
The InChIKey is YZZVCLAGBLPBGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClN3O4.ClH/c13-7-1-2-10-9(5-7)11(16-20-10)19-6-8(14)3-4-18-12(15)17;/h1-2,5,8H,3-4,6,14H2,(H2,15,17);1H.
What are the key properties of [3-amino-4-[(5-chloro-1,2-benzoxazol-3-yl)oxy]butyl] carbamate;hydrochloride?
[3-amino-4-[(5-chloro-1,2-benzoxazol-3-yl)oxy]butyl] carbamate;hydrochloride has a molecular weight of 336.18 g/mol, XLogP of 2.09, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-amino-4-[(5-chloro-1,2-benzoxazol-3-yl)oxy]butyl] carbamate;hydrochloride is sourced from PubChem (CID 23368426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).