About [3-[(5-chloro-1,2-benzoxazol-3-yl)oxy]-2-(methylamino)propyl] carbamate
[3-[(5-chloro-1,2-benzoxazol-3-yl)oxy]-2-(methylamino)propyl] carbamate (PubChem CID 23368480) has the molecular formula C12H14ClN3O4
and a molecular weight of 299.71 g/mol. Its IUPAC name is [3-[(5-chloro-1,2-benzoxazol-3-yl)oxy]-2-(methylamino)propyl] carbamate.
Molecular Properties
| Compound Name | [3-[(5-chloro-1,2-benzoxazol-3-yl)oxy]-2-(methylamino)propyl] carbamate |
| PubChem CID | 23368480 |
| Molecular Formula | C12H14ClN3O4 |
| Molecular Weight | 299.71 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | [3-[(5-chloro-1,2-benzoxazol-3-yl)oxy]-2-(methylamino)propyl] carbamate |
| SMILES | CNC(COC(N)=O)COc1noc2ccc(Cl)cc12 |
| InChI | InChI=1S/C12H14ClN3O4/c1-15-8(6-19-12(14)17)5-18-11-9-4-7(13)2-3-10(9)20-16-11/h2-4,8,15H,5-6H2,1H3,(H2,14,17) |
| InChIKey | WJSCUEYFKKNCEI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.71 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-[(5-chloro-1,2-benzoxazol-3-yl)oxy]-2-(methylamino)propyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(5-chloro-1,2-benzoxazol-3-yl)oxy]-2-(methylamino)propyl] carbamate?
The IUPAC name of [3-[(5-chloro-1,2-benzoxazol-3-yl)oxy]-2-(methylamino)propyl] carbamate (CID 23368480) is [3-[(5-chloro-1,2-benzoxazol-3-yl)oxy]-2-(methylamino)propyl] carbamate.
What is the SMILES notation for [3-[(5-chloro-1,2-benzoxazol-3-yl)oxy]-2-(methylamino)propyl] carbamate?
The canonical SMILES for [3-[(5-chloro-1,2-benzoxazol-3-yl)oxy]-2-(methylamino)propyl] carbamate is CNC(COC(N)=O)COc1noc2ccc(Cl)cc12.
What is the InChIKey of [3-[(5-chloro-1,2-benzoxazol-3-yl)oxy]-2-(methylamino)propyl] carbamate?
The InChIKey is WJSCUEYFKKNCEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClN3O4/c1-15-8(6-19-12(14)17)5-18-11-9-4-7(13)2-3-10(9)20-16-11/h2-4,8,15H,5-6H2,1H3,(H2,14,17).
What are the key properties of [3-[(5-chloro-1,2-benzoxazol-3-yl)oxy]-2-(methylamino)propyl] carbamate?
[3-[(5-chloro-1,2-benzoxazol-3-yl)oxy]-2-(methylamino)propyl] carbamate has a molecular weight of 299.71 g/mol, XLogP of 1.54, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(5-chloro-1,2-benzoxazol-3-yl)oxy]-2-(methylamino)propyl] carbamate is sourced from PubChem (CID 23368480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).