About [2-amino-3-[(5-chloro-1,2-benzoxazol-3-yl)oxy]propyl] sulfamate;hydrochloride
[2-amino-3-[(5-chloro-1,2-benzoxazol-3-yl)oxy]propyl] sulfamate;hydrochloride (PubChem CID 23368565) has the molecular formula C10H13Cl2N3O5S
and a molecular weight of 358.20 g/mol. Its IUPAC name is [2-amino-3-[(5-chloro-1,2-benzoxazol-3-yl)oxy]propyl] sulfamate;hydrochloride.
Molecular Properties
| Compound Name | [2-amino-3-[(5-chloro-1,2-benzoxazol-3-yl)oxy]propyl] sulfamate;hydrochloride |
| PubChem CID | 23368565 |
| Molecular Formula | C10H13Cl2N3O5S |
| Molecular Weight | 358.20 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | [2-amino-3-[(5-chloro-1,2-benzoxazol-3-yl)oxy]propyl] sulfamate;hydrochloride |
| SMILES | Cl.NC(COc1noc2ccc(Cl)cc12)COS(N)(=O)=O |
| InChI | InChI=1S/C10H12ClN3O5S.ClH/c11-6-1-2-9-8(3-6)10(14-19-9)17-4-7(12)5-18-20(13,15)16;/h1-3,7H,4-5,12H2,(H2,13,15,16);1H |
| InChIKey | VZLMQOLFUGTGNT-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.20 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-amino-3-[(5-chloro-1,2-benzoxazol-3-yl)oxy]propyl] sulfamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-amino-3-[(5-chloro-1,2-benzoxazol-3-yl)oxy]propyl] sulfamate;hydrochloride?
The IUPAC name of [2-amino-3-[(5-chloro-1,2-benzoxazol-3-yl)oxy]propyl] sulfamate;hydrochloride (CID 23368565) is [2-amino-3-[(5-chloro-1,2-benzoxazol-3-yl)oxy]propyl] sulfamate;hydrochloride.
What is the SMILES notation for [2-amino-3-[(5-chloro-1,2-benzoxazol-3-yl)oxy]propyl] sulfamate;hydrochloride?
The canonical SMILES for [2-amino-3-[(5-chloro-1,2-benzoxazol-3-yl)oxy]propyl] sulfamate;hydrochloride is Cl.NC(COc1noc2ccc(Cl)cc12)COS(N)(=O)=O.
What is the InChIKey of [2-amino-3-[(5-chloro-1,2-benzoxazol-3-yl)oxy]propyl] sulfamate;hydrochloride?
The InChIKey is VZLMQOLFUGTGNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClN3O5S.ClH/c11-6-1-2-9-8(3-6)10(14-19-9)17-4-7(12)5-18-20(13,15)16;/h1-3,7H,4-5,12H2,(H2,13,15,16);1H.
What are the key properties of [2-amino-3-[(5-chloro-1,2-benzoxazol-3-yl)oxy]propyl] sulfamate;hydrochloride?
[2-amino-3-[(5-chloro-1,2-benzoxazol-3-yl)oxy]propyl] sulfamate;hydrochloride has a molecular weight of 358.20 g/mol, XLogP of 0.83, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-amino-3-[(5-chloro-1,2-benzoxazol-3-yl)oxy]propyl] sulfamate;hydrochloride is sourced from PubChem (CID 23368565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).