About [2-(N-methylanilino)-2-oxoethyl] 2,3-dimethylbenzoate
[2-(N-methylanilino)-2-oxoethyl] 2,3-dimethylbenzoate (PubChem CID 2336883) has the molecular formula C18H19NO3
and a molecular weight of 297.35 g/mol. Its IUPAC name is [2-(N-methylanilino)-2-oxoethyl] 2,3-dimethylbenzoate.
Molecular Properties
| Compound Name | [2-(N-methylanilino)-2-oxoethyl] 2,3-dimethylbenzoate |
| PubChem CID | 2336883 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | [2-(N-methylanilino)-2-oxoethyl] 2,3-dimethylbenzoate |
| SMILES | Cc1cccc(C(=O)OCC(=O)N(C)c2ccccc2)c1C |
| InChI | InChI=1S/C18H19NO3/c1-13-8-7-11-16(14(13)2)18(21)22-12-17(20)19(3)15-9-5-4-6-10-15/h4-11H,12H2,1-3H3 |
| InChIKey | HYBSYVMWPNORBN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(N-methylanilino)-2-oxoethyl] 2,3-dimethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(N-methylanilino)-2-oxoethyl] 2,3-dimethylbenzoate?
The IUPAC name of [2-(N-methylanilino)-2-oxoethyl] 2,3-dimethylbenzoate (CID 2336883) is [2-(N-methylanilino)-2-oxoethyl] 2,3-dimethylbenzoate.
What is the SMILES notation for [2-(N-methylanilino)-2-oxoethyl] 2,3-dimethylbenzoate?
The canonical SMILES for [2-(N-methylanilino)-2-oxoethyl] 2,3-dimethylbenzoate is Cc1cccc(C(=O)OCC(=O)N(C)c2ccccc2)c1C.
What is the InChIKey of [2-(N-methylanilino)-2-oxoethyl] 2,3-dimethylbenzoate?
The InChIKey is HYBSYVMWPNORBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO3/c1-13-8-7-11-16(14(13)2)18(21)22-12-17(20)19(3)15-9-5-4-6-10-15/h4-11H,12H2,1-3H3.
What are the key properties of [2-(N-methylanilino)-2-oxoethyl] 2,3-dimethylbenzoate?
[2-(N-methylanilino)-2-oxoethyl] 2,3-dimethylbenzoate has a molecular weight of 297.35 g/mol, XLogP of 3.12, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(N-methylanilino)-2-oxoethyl] 2,3-dimethylbenzoate is sourced from PubChem (CID 2336883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).