C10H15Cl2N3 — CID 23369489
[1-(6-chloro-2-pyridinyl)pyrrolidin-2-yl]methanamine;hydrochloride (PubChem CID 23369489) has the molecular formula C10H15Cl2N3 and a molecular weight of 248.16 g/mol. Its IUPAC name is [1-(6-chloro-2-pyridinyl)pyrrolidin-2-yl]methanamine;hydrochloride.
| Compound Name | [1-(6-chloro-2-pyridinyl)pyrrolidin-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 23369489 |
| Molecular Formula | C10H15Cl2N3 |
| Molecular Weight | 248.16 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | [1-(6-chloro-2-pyridinyl)pyrrolidin-2-yl]methanamine;hydrochloride |
| SMILES | Cl.NCC1CCCN1c1cccc(Cl)n1 |
| InChI | InChI=1S/C10H14ClN3.ClH/c11-9-4-1-5-10(13-9)14-6-2-3-8(14)7-12;/h1,4-5,8H,2-3,6-7,12H2;1H |
| InChIKey | JXHNYHSUTZRRMP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.16 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|