C15H19ClN2O2S — CID 23369588
2-(2-aminoethylsulfanylmethyl)-5-methyl-3,6-dihydro-2H-furo[2,3-f]quinolin-7-one;hydrochloride (PubChem CID 23369588) has the molecular formula C15H19ClN2O2S and a molecular weight of 326.85 g/mol. Its IUPAC name is 2-(2-aminoethylsulfanylmethyl)-5-methyl-3,6-dihydro-2H-furo[2,3-f]quinolin-7-one;hydrochloride.
| Compound Name | 2-(2-aminoethylsulfanylmethyl)-5-methyl-3,6-dihydro-2H-furo[2,3-f]quinolin-7-one;hydrochloride |
|---|---|
| PubChem CID | 23369588 |
| Molecular Formula | C15H19ClN2O2S |
| Molecular Weight | 326.85 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-(2-aminoethylsulfanylmethyl)-5-methyl-3,6-dihydro-2H-furo[2,3-f]quinolin-7-one;hydrochloride |
| SMILES | Cc1cc2c(c3ccc(=O)[nH]c13)OC(CSCCN)C2.Cl |
| InChI | InChI=1S/C15H18N2O2S.ClH/c1-9-6-10-7-11(8-20-5-4-16)19-15(10)12-2-3-13(18)17-14(9)12;/h2-3,6,11H,4-5,7-8,16H2,1H3,(H,17,18);1H |
| InChIKey | RAFPBINMSSIHNL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.85 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|