C12H15NO2 — CID 23369635
5-hydroxy-3,3,8-trimethyl-1,4-dihydroquinolin-2-one (PubChem CID 23369635) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 5-hydroxy-3,3,8-trimethyl-1,4-dihydroquinolin-2-one.
| Compound Name | 5-hydroxy-3,3,8-trimethyl-1,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 23369635 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 5-hydroxy-3,3,8-trimethyl-1,4-dihydroquinolin-2-one |
| SMILES | Cc1ccc(O)c2c1NC(=O)C(C)(C)C2 |
| InChI | InChI=1S/C12H15NO2/c1-7-4-5-9(14)8-6-12(2,3)11(15)13-10(7)8/h4-5,14H,6H2,1-3H3,(H,13,15) |
| InChIKey | DZIAEVUPXPHBES-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |