About 2-(fluoromethyl)-5-methyl-3,6-dihydro-2H-furo[2,3-f]quinolin-7-one
2-(fluoromethyl)-5-methyl-3,6-dihydro-2H-furo[2,3-f]quinolin-7-one (PubChem CID 23369788) has the molecular formula C13H12FNO2
and a molecular weight of 233.24 g/mol. Its IUPAC name is 2-(fluoromethyl)-5-methyl-3,6-dihydro-2H-furo[2,3-f]quinolin-7-one.
Molecular Properties
| Compound Name | 2-(fluoromethyl)-5-methyl-3,6-dihydro-2H-furo[2,3-f]quinolin-7-one |
| PubChem CID | 23369788 |
| Molecular Formula | C13H12FNO2 |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 2-(fluoromethyl)-5-methyl-3,6-dihydro-2H-furo[2,3-f]quinolin-7-one |
| SMILES | Cc1cc2c(c3ccc(=O)[nH]c13)OC(CF)C2 |
| InChI | InChI=1S/C13H12FNO2/c1-7-4-8-5-9(6-14)17-13(8)10-2-3-11(16)15-12(7)10/h2-4,9H,5-6H2,1H3,(H,15,16) |
| InChIKey | MWMCVZXKIGXHRP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(fluoromethyl)-5-methyl-3,6-dihydro-2H-furo[2,3-f]quinolin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(fluoromethyl)-5-methyl-3,6-dihydro-2H-furo[2,3-f]quinolin-7-one?
The IUPAC name of 2-(fluoromethyl)-5-methyl-3,6-dihydro-2H-furo[2,3-f]quinolin-7-one (CID 23369788) is 2-(fluoromethyl)-5-methyl-3,6-dihydro-2H-furo[2,3-f]quinolin-7-one.
What is the SMILES notation for 2-(fluoromethyl)-5-methyl-3,6-dihydro-2H-furo[2,3-f]quinolin-7-one?
The canonical SMILES for 2-(fluoromethyl)-5-methyl-3,6-dihydro-2H-furo[2,3-f]quinolin-7-one is Cc1cc2c(c3ccc(=O)[nH]c13)OC(CF)C2.
What is the InChIKey of 2-(fluoromethyl)-5-methyl-3,6-dihydro-2H-furo[2,3-f]quinolin-7-one?
The InChIKey is MWMCVZXKIGXHRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12FNO2/c1-7-4-8-5-9(6-14)17-13(8)10-2-3-11(16)15-12(7)10/h2-4,9H,5-6H2,1H3,(H,15,16).
What are the key properties of 2-(fluoromethyl)-5-methyl-3,6-dihydro-2H-furo[2,3-f]quinolin-7-one?
2-(fluoromethyl)-5-methyl-3,6-dihydro-2H-furo[2,3-f]quinolin-7-one has a molecular weight of 233.24 g/mol, XLogP of 2.11, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(fluoromethyl)-5-methyl-3,6-dihydro-2H-furo[2,3-f]quinolin-7-one is sourced from PubChem (CID 23369788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).