About 1-piperidin-4-yl-2,3-dihydropyridin-6-one
1-piperidin-4-yl-2,3-dihydropyridin-6-one (PubChem CID 23369958) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-piperidin-4-yl-2,3-dihydropyridin-6-one.
Molecular Properties
| Compound Name | 1-piperidin-4-yl-2,3-dihydropyridin-6-one |
| PubChem CID | 23369958 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 1-piperidin-4-yl-2,3-dihydropyridin-6-one |
| SMILES | O=C1C=CCCN1C1CCNCC1 |
| InChI | InChI=1S/C10H16N2O/c13-10-3-1-2-8-12(10)9-4-6-11-7-5-9/h1,3,9,11H,2,4-8H2 |
| InChIKey | PWOYYJBWCSCTPF-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-piperidin-4-yl-2,3-dihydropyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-piperidin-4-yl-2,3-dihydropyridin-6-one?
The IUPAC name of 1-piperidin-4-yl-2,3-dihydropyridin-6-one (CID 23369958) is 1-piperidin-4-yl-2,3-dihydropyridin-6-one.
What is the SMILES notation for 1-piperidin-4-yl-2,3-dihydropyridin-6-one?
The canonical SMILES for 1-piperidin-4-yl-2,3-dihydropyridin-6-one is O=C1C=CCCN1C1CCNCC1.
What is the InChIKey of 1-piperidin-4-yl-2,3-dihydropyridin-6-one?
The InChIKey is PWOYYJBWCSCTPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O/c13-10-3-1-2-8-12(10)9-4-6-11-7-5-9/h1,3,9,11H,2,4-8H2.
What are the key properties of 1-piperidin-4-yl-2,3-dihydropyridin-6-one?
1-piperidin-4-yl-2,3-dihydropyridin-6-one has a molecular weight of 180.25 g/mol, XLogP of 0.53, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-piperidin-4-yl-2,3-dihydropyridin-6-one is sourced from PubChem (CID 23369958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).