C10H22O3Si — CID 23370773
2,2-dimethoxy-5,5,6,6-tetramethyloxasilinane (PubChem CID 23370773) has the molecular formula C10H22O3Si and a molecular weight of 218.37 g/mol. Its IUPAC name is 2,2-dimethoxy-5,5,6,6-tetramethyloxasilinane.
| Compound Name | 2,2-dimethoxy-5,5,6,6-tetramethyloxasilinane |
|---|---|
| PubChem CID | 23370773 |
| Molecular Formula | C10H22O3Si |
| Molecular Weight | 218.37 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 2,2-dimethoxy-5,5,6,6-tetramethyloxasilinane |
| SMILES | CO[Si]1(OC)CCC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C10H22O3Si/c1-9(2)7-8-14(11-5,12-6)13-10(9,3)4/h7-8H2,1-6H3 |
| InChIKey | AVESWTXVLLFWBU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|