About 2-isocyanato-4H-chromene
2-isocyanato-4H-chromene (PubChem CID 23371908) has the molecular formula C10H7NO2
and a molecular weight of 173.17 g/mol. Its IUPAC name is 2-isocyanato-4H-chromene.
Molecular Properties
| Compound Name | 2-isocyanato-4H-chromene |
| PubChem CID | 23371908 |
| Molecular Formula | C10H7NO2 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | 2-isocyanato-4H-chromene |
| SMILES | O=C=NC1=CCc2ccccc2O1 |
| InChI | InChI=1S/C10H7NO2/c12-7-11-10-6-5-8-3-1-2-4-9(8)13-10/h1-4,6H,5H2 |
| InChIKey | RILAIMJNFIVQOZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-isocyanato-4H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isocyanato-4H-chromene?
The IUPAC name of 2-isocyanato-4H-chromene (CID 23371908) is 2-isocyanato-4H-chromene.
What is the SMILES notation for 2-isocyanato-4H-chromene?
The canonical SMILES for 2-isocyanato-4H-chromene is O=C=NC1=CCc2ccccc2O1.
What is the InChIKey of 2-isocyanato-4H-chromene?
The InChIKey is RILAIMJNFIVQOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO2/c12-7-11-10-6-5-8-3-1-2-4-9(8)13-10/h1-4,6H,5H2.
What are the key properties of 2-isocyanato-4H-chromene?
2-isocyanato-4H-chromene has a molecular weight of 173.17 g/mol, XLogP of 1.80, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isocyanato-4H-chromene is sourced from PubChem (CID 23371908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).