About 3-(furan-2-yl)-7,8-dihydroxychromen-2-one
3-(furan-2-yl)-7,8-dihydroxychromen-2-one (PubChem CID 23371929) has the molecular formula C13H8O5
and a molecular weight of 244.20 g/mol. Its IUPAC name is 3-(furan-2-yl)-7,8-dihydroxychromen-2-one.
Molecular Properties
| Compound Name | 3-(furan-2-yl)-7,8-dihydroxychromen-2-one |
| PubChem CID | 23371929 |
| Molecular Formula | C13H8O5 |
| Molecular Weight | 244.20 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 3-(furan-2-yl)-7,8-dihydroxychromen-2-one |
| SMILES | O=c1oc2c(O)c(O)ccc2cc1-c1ccco1 |
| InChI | InChI=1S/C13H8O5/c14-9-4-3-7-6-8(10-2-1-5-17-10)13(16)18-12(7)11(9)15/h1-6,14-15H |
| InChIKey | OWSXMBLUXZSUKG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.20 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-(furan-2-yl)-7,8-dihydroxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(furan-2-yl)-7,8-dihydroxychromen-2-one?
The IUPAC name of 3-(furan-2-yl)-7,8-dihydroxychromen-2-one (CID 23371929) is 3-(furan-2-yl)-7,8-dihydroxychromen-2-one.
What is the SMILES notation for 3-(furan-2-yl)-7,8-dihydroxychromen-2-one?
The canonical SMILES for 3-(furan-2-yl)-7,8-dihydroxychromen-2-one is O=c1oc2c(O)c(O)ccc2cc1-c1ccco1.
What is the InChIKey of 3-(furan-2-yl)-7,8-dihydroxychromen-2-one?
The InChIKey is OWSXMBLUXZSUKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8O5/c14-9-4-3-7-6-8(10-2-1-5-17-10)13(16)18-12(7)11(9)15/h1-6,14-15H.
What are the key properties of 3-(furan-2-yl)-7,8-dihydroxychromen-2-one?
3-(furan-2-yl)-7,8-dihydroxychromen-2-one has a molecular weight of 244.20 g/mol, XLogP of 2.46, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(furan-2-yl)-7,8-dihydroxychromen-2-one is sourced from PubChem (CID 23371929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).