C20H14BrF23 — CID 23372336
1,2-bis(trifluoromethyl)adamantane;1-bromo-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane (PubChem CID 23372336) has the molecular formula C20H14BrF23 and a molecular weight of 771.19 g/mol. Its IUPAC name is 1,2-bis(trifluoromethyl)adamantane;1-bromo-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane.
| Compound Name | 1,2-bis(trifluoromethyl)adamantane;1-bromo-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane |
|---|---|
| PubChem CID | 23372336 |
| Molecular Formula | C20H14BrF23 |
| Molecular Weight | 771.19 g/mol |
| Exact Mass | 769.99 |
| IUPAC Name | 1,2-bis(trifluoromethyl)adamantane;1-bromo-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Br.FC(F)(F)C1C2CC3CC(C2)CC1(C(F)(F)F)C3 |
| InChI | InChI=1S/C12H14F6.C8BrF17/c13-11(14,15)9-8-2-6-1-7(3-8)5-10(9,4-6)12(16,17)18;9-7(22,23)5(18,19)3(14,15)1(10,11)2(12,13)4(16,17)6(20,21)8(24,25)26/h6-9H,1-5H2; |
| InChIKey | HIJZSESLMSNTGK-UHFFFAOYSA-N |
| XLogP | 10.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.19 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|