About ethenyl(triethoxy)silane;styrene
ethenyl(triethoxy)silane;styrene (PubChem CID 23372435) has the molecular formula C16H26O3Si
and a molecular weight of 294.47 g/mol. Its IUPAC name is ethenyl(triethoxy)silane;styrene.
Molecular Properties
| Compound Name | ethenyl(triethoxy)silane;styrene |
| PubChem CID | 23372435 |
| Molecular Formula | C16H26O3Si |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | ethenyl(triethoxy)silane;styrene |
| SMILES | C=C[Si](OCC)(OCC)OCC.C=Cc1ccccc1 |
| InChI | InChI=1S/C8H18O3Si.C8H8/c1-5-9-12(8-4,10-6-2)11-7-3;1-2-8-6-4-3-5-7-8/h8H,4-7H2,1-3H3;2-7H,1H2 |
| InChIKey | VUCMPVJHHMKNRY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethenyl(triethoxy)silane;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl(triethoxy)silane;styrene?
The IUPAC name of ethenyl(triethoxy)silane;styrene (CID 23372435) is ethenyl(triethoxy)silane;styrene.
What is the SMILES notation for ethenyl(triethoxy)silane;styrene?
The canonical SMILES for ethenyl(triethoxy)silane;styrene is C=C[Si](OCC)(OCC)OCC.C=Cc1ccccc1.
What is the InChIKey of ethenyl(triethoxy)silane;styrene?
The InChIKey is VUCMPVJHHMKNRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O3Si.C8H8/c1-5-9-12(8-4,10-6-2)11-7-3;1-2-8-6-4-3-5-7-8/h8H,4-7H2,1-3H3;2-7H,1H2.
What are the key properties of ethenyl(triethoxy)silane;styrene?
ethenyl(triethoxy)silane;styrene has a molecular weight of 294.47 g/mol, XLogP of 4.09, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl(triethoxy)silane;styrene is sourced from PubChem (CID 23372435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).