About 5-(4-chlorophenyl)-2,2-dimethylcyclohexan-1-ol
5-(4-chlorophenyl)-2,2-dimethylcyclohexan-1-ol (PubChem CID 23373017) has the molecular formula C14H19ClO
and a molecular weight of 238.76 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2,2-dimethylcyclohexan-1-ol.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)-2,2-dimethylcyclohexan-1-ol |
| PubChem CID | 23373017 |
| Molecular Formula | C14H19ClO |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 5-(4-chlorophenyl)-2,2-dimethylcyclohexan-1-ol |
| SMILES | CC1(C)CCC(c2ccc(Cl)cc2)CC1O |
| InChI | InChI=1S/C14H19ClO/c1-14(2)8-7-11(9-13(14)16)10-3-5-12(15)6-4-10/h3-6,11,13,16H,7-9H2,1-2H3 |
| InChIKey | KNISHEXUIDJDIZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(4-chlorophenyl)-2,2-dimethylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)-2,2-dimethylcyclohexan-1-ol?
The IUPAC name of 5-(4-chlorophenyl)-2,2-dimethylcyclohexan-1-ol (CID 23373017) is 5-(4-chlorophenyl)-2,2-dimethylcyclohexan-1-ol.
What is the SMILES notation for 5-(4-chlorophenyl)-2,2-dimethylcyclohexan-1-ol?
The canonical SMILES for 5-(4-chlorophenyl)-2,2-dimethylcyclohexan-1-ol is CC1(C)CCC(c2ccc(Cl)cc2)CC1O.
What is the InChIKey of 5-(4-chlorophenyl)-2,2-dimethylcyclohexan-1-ol?
The InChIKey is KNISHEXUIDJDIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19ClO/c1-14(2)8-7-11(9-13(14)16)10-3-5-12(15)6-4-10/h3-6,11,13,16H,7-9H2,1-2H3.
What are the key properties of 5-(4-chlorophenyl)-2,2-dimethylcyclohexan-1-ol?
5-(4-chlorophenyl)-2,2-dimethylcyclohexan-1-ol has a molecular weight of 238.76 g/mol, XLogP of 3.99, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)-2,2-dimethylcyclohexan-1-ol is sourced from PubChem (CID 23373017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).