C14H16NO4S3+ — CID 2337330
3-(5-methoxy-2-methylthieno[2,3-e][1,3]benzothiazol-1-ium-1-yl)propane-1-sulfonic acid (PubChem CID 2337330) has the molecular formula C14H16NO4S3+ and a molecular weight of 358.49 g/mol. Its IUPAC name is 3-(5-methoxy-2-methylthieno[2,3-e][1,3]benzothiazol-1-ium-1-yl)propane-1-sulfonic acid.
| Compound Name | 3-(5-methoxy-2-methylthieno[2,3-e][1,3]benzothiazol-1-ium-1-yl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 2337330 |
| Molecular Formula | C14H16NO4S3+ |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 3-(5-methoxy-2-methylthieno[2,3-e][1,3]benzothiazol-1-ium-1-yl)propane-1-sulfonic acid |
| SMILES | COc1cc2sc(C)[n+](CCCS(=O)(=O)O)c2c2sccc12 |
| InChI | InChI=1S/C14H15NO4S3/c1-9-15(5-3-7-22(16,17)18)13-12(21-9)8-11(19-2)10-4-6-20-14(10)13/h4,6,8H,3,5,7H2,1-2H3/p+1 |
| InChIKey | IQFDEOOVCOQEJX-UHFFFAOYSA-O |
| XLogP | 3.00 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|