About 1-(benzenesulfonyl)-N-(1,6-dibromonaphthalen-2-yl)cyclopentane-1-carboxamide
1-(benzenesulfonyl)-N-(1,6-dibromonaphthalen-2-yl)cyclopentane-1-carboxamide (PubChem CID 2337394) has the molecular formula C22H19Br2NO3S
and a molecular weight of 537.27 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-(1,6-dibromonaphthalen-2-yl)cyclopentane-1-carboxamide.
Molecular Properties
| Compound Name | 1-(benzenesulfonyl)-N-(1,6-dibromonaphthalen-2-yl)cyclopentane-1-carboxamide |
| PubChem CID | 2337394 |
| Molecular Formula | C22H19Br2NO3S |
| Molecular Weight | 537.27 g/mol |
| Exact Mass | 534.95 |
| IUPAC Name | 1-(benzenesulfonyl)-N-(1,6-dibromonaphthalen-2-yl)cyclopentane-1-carboxamide |
| SMILES | O=C(Nc1ccc2cc(Br)ccc2c1Br)C1(S(=O)(=O)c2ccccc2)CCCC1 |
| InChI | InChI=1S/C22H19Br2NO3S/c23-16-9-10-18-15(14-16)8-11-19(20(18)24)25-21(26)22(12-4-5-13-22)29(27,28)17-6-2-1-3-7-17/h1-3,6-11,14H,4-5,12-13H2,(H,25,26) |
| InChIKey | VRBKMILHLPCBTD-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 537.27 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(benzenesulfonyl)-N-(1,6-dibromonaphthalen-2-yl)cyclopentane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzenesulfonyl)-N-(1,6-dibromonaphthalen-2-yl)cyclopentane-1-carboxamide?
The IUPAC name of 1-(benzenesulfonyl)-N-(1,6-dibromonaphthalen-2-yl)cyclopentane-1-carboxamide (CID 2337394) is 1-(benzenesulfonyl)-N-(1,6-dibromonaphthalen-2-yl)cyclopentane-1-carboxamide.
What is the SMILES notation for 1-(benzenesulfonyl)-N-(1,6-dibromonaphthalen-2-yl)cyclopentane-1-carboxamide?
The canonical SMILES for 1-(benzenesulfonyl)-N-(1,6-dibromonaphthalen-2-yl)cyclopentane-1-carboxamide is O=C(Nc1ccc2cc(Br)ccc2c1Br)C1(S(=O)(=O)c2ccccc2)CCCC1.
What is the InChIKey of 1-(benzenesulfonyl)-N-(1,6-dibromonaphthalen-2-yl)cyclopentane-1-carboxamide?
The InChIKey is VRBKMILHLPCBTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19Br2NO3S/c23-16-9-10-18-15(14-16)8-11-19(20(18)24)25-21(26)22(12-4-5-13-22)29(27,28)17-6-2-1-3-7-17/h1-3,6-11,14H,4-5,12-13H2,(H,25,26).
What are the key properties of 1-(benzenesulfonyl)-N-(1,6-dibromonaphthalen-2-yl)cyclopentane-1-carboxamide?
1-(benzenesulfonyl)-N-(1,6-dibromonaphthalen-2-yl)cyclopentane-1-carboxamide has a molecular weight of 537.27 g/mol, XLogP of 6.09, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzenesulfonyl)-N-(1,6-dibromonaphthalen-2-yl)cyclopentane-1-carboxamide is sourced from PubChem (CID 2337394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).