About 4-N,5-N-dipropyl-2H-pyran-4,5-diamine
4-N,5-N-dipropyl-2H-pyran-4,5-diamine (PubChem CID 23374279) has the molecular formula C11H20N2O
and a molecular weight of 196.29 g/mol. Its IUPAC name is 4-N,5-N-dipropyl-2H-pyran-4,5-diamine.
Molecular Properties
| Compound Name | 4-N,5-N-dipropyl-2H-pyran-4,5-diamine |
| PubChem CID | 23374279 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 4-N,5-N-dipropyl-2H-pyran-4,5-diamine |
| SMILES | CCCNC1=CCOC=C1NCCC |
| InChI | InChI=1S/C11H20N2O/c1-3-6-12-10-5-8-14-9-11(10)13-7-4-2/h5,9,12-13H,3-4,6-8H2,1-2H3 |
| InChIKey | FXKKBDWUUMPLRH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-N,5-N-dipropyl-2H-pyran-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N,5-N-dipropyl-2H-pyran-4,5-diamine?
The IUPAC name of 4-N,5-N-dipropyl-2H-pyran-4,5-diamine (CID 23374279) is 4-N,5-N-dipropyl-2H-pyran-4,5-diamine.
What is the SMILES notation for 4-N,5-N-dipropyl-2H-pyran-4,5-diamine?
The canonical SMILES for 4-N,5-N-dipropyl-2H-pyran-4,5-diamine is CCCNC1=CCOC=C1NCCC.
What is the InChIKey of 4-N,5-N-dipropyl-2H-pyran-4,5-diamine?
The InChIKey is FXKKBDWUUMPLRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O/c1-3-6-12-10-5-8-14-9-11(10)13-7-4-2/h5,9,12-13H,3-4,6-8H2,1-2H3.
What are the key properties of 4-N,5-N-dipropyl-2H-pyran-4,5-diamine?
4-N,5-N-dipropyl-2H-pyran-4,5-diamine has a molecular weight of 196.29 g/mol, XLogP of 1.74, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N,5-N-dipropyl-2H-pyran-4,5-diamine is sourced from PubChem (CID 23374279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).