C14H27N3O — CID 23374280
3-N,4-N,5-N-tripropyl-2H-pyran-3,4,5-triamine (PubChem CID 23374280) has the molecular formula C14H27N3O and a molecular weight of 253.39 g/mol. Its IUPAC name is 3-N,4-N,5-N-tripropyl-2H-pyran-3,4,5-triamine.
| Compound Name | 3-N,4-N,5-N-tripropyl-2H-pyran-3,4,5-triamine |
|---|---|
| PubChem CID | 23374280 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | 3-N,4-N,5-N-tripropyl-2H-pyran-3,4,5-triamine |
| SMILES | CCCNC1=COCC(NCCC)=C1NCCC |
| InChI | InChI=1S/C14H27N3O/c1-4-7-15-12-10-18-11-13(16-8-5-2)14(12)17-9-6-3/h10,15-17H,4-9,11H2,1-3H3 |
| InChIKey | GTFUHBSTTLJHNA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 45.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |