C29H57N3O — CID 23374283
3-N,3-N,4-N,4-N,5-N,5-N-hexabutyl-2H-pyran-3,4,5-triamine (PubChem CID 23374283) has the molecular formula C29H57N3O and a molecular weight of 463.80 g/mol. Its IUPAC name is 3-N,3-N,4-N,4-N,5-N,5-N-hexabutyl-2H-pyran-3,4,5-triamine.
| Compound Name | 3-N,3-N,4-N,4-N,5-N,5-N-hexabutyl-2H-pyran-3,4,5-triamine |
|---|---|
| PubChem CID | 23374283 |
| Molecular Formula | C29H57N3O |
| Molecular Weight | 463.80 g/mol |
| Exact Mass | 463.45 |
| IUPAC Name | 3-N,3-N,4-N,4-N,5-N,5-N-hexabutyl-2H-pyran-3,4,5-triamine |
| SMILES | CCCCN(CCCC)C1=COCC(N(CCCC)CCCC)=C1N(CCCC)CCCC |
| InChI | InChI=1S/C29H57N3O/c1-7-13-19-30(20-14-8-2)27-25-33-26-28(31(21-15-9-3)22-16-10-4)29(27)32(23-17-11-5)24-18-12-6/h25H,7-24,26H2,1-6H3 |
| InChIKey | DANDVICXXNUMHP-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.80 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |