C31H42O6 — CID 23374455
[2-oxo-2-(1,2,6-trimethoxycyclohexa-2,5-dien-1-yl)ethyl] (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate (PubChem CID 23374455) has the molecular formula C31H42O6 and a molecular weight of 510.67 g/mol. Its IUPAC name is [2-oxo-2-(1,2,6-trimethoxycyclohexa-2,5-dien-1-yl)ethyl] (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate.
| Compound Name | [2-oxo-2-(1,2,6-trimethoxycyclohexa-2,5-dien-1-yl)ethyl] (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 23374455 |
| Molecular Formula | C31H42O6 |
| Molecular Weight | 510.67 g/mol |
| Exact Mass | 510.30 |
| IUPAC Name | [2-oxo-2-(1,2,6-trimethoxycyclohexa-2,5-dien-1-yl)ethyl] (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
| SMILES | COC1=CCC=C(OC)C1(OC)C(=O)COC(=O)/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C31H42O6/c1-22(17-18-25-24(3)14-11-19-30(25,4)5)12-9-13-23(2)20-29(33)37-21-26(32)31(36-8)27(34-6)15-10-16-28(31)35-7/h9,12-13,15-18,20H,10-11,14,19,21H2,1-8H3/b13-9+,18-17+,22-12+,23-20+ |
| InChIKey | XBMKGODDKIWVED-JFFGIHJASA-N |
| XLogP | 6.48 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.67 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|