C31H42O3 — CID 23374466
[2-oxo-2-(1,3,5-trimethylcyclohexa-2,5-dien-1-yl)ethyl] (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate (PubChem CID 23374466) has the molecular formula C31H42O3 and a molecular weight of 462.67 g/mol. Its IUPAC name is [2-oxo-2-(1,3,5-trimethylcyclohexa-2,5-dien-1-yl)ethyl] (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate.
| Compound Name | [2-oxo-2-(1,3,5-trimethylcyclohexa-2,5-dien-1-yl)ethyl] (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 23374466 |
| Molecular Formula | C31H42O3 |
| Molecular Weight | 462.67 g/mol |
| Exact Mass | 462.31 |
| IUPAC Name | [2-oxo-2-(1,3,5-trimethylcyclohexa-2,5-dien-1-yl)ethyl] (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
| SMILES | CC1=CC(C)(C(=O)COC(=O)/C=C(C)/C=C/C=C(C)/C=C/C2=C(C)CCCC2(C)C)C=C(C)C1 |
| InChI | InChI=1S/C31H42O3/c1-22(14-15-27-26(5)13-10-16-30(27,6)7)11-9-12-23(2)18-29(33)34-21-28(32)31(8)19-24(3)17-25(4)20-31/h9,11-12,14-15,18-20H,10,13,16-17,21H2,1-8H3/b12-9+,15-14+,22-11+,23-18+ |
| InChIKey | PJRMUJYXESPUOS-SGLCXXOFSA-N |
| XLogP | 7.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.67 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|