C13H14F3NO6S2 — CID 23374801
[5-(4-methylsulfonylphenyl)-2-(trifluoromethyl)-4,5-dihydro-1,3-oxazol-4-yl]methyl methanesulfonate (PubChem CID 23374801) has the molecular formula C13H14F3NO6S2 and a molecular weight of 401.38 g/mol. Its IUPAC name is [5-(4-methylsulfonylphenyl)-2-(trifluoromethyl)-4,5-dihydro-1,3-oxazol-4-yl]methyl methanesulfonate.
| Compound Name | [5-(4-methylsulfonylphenyl)-2-(trifluoromethyl)-4,5-dihydro-1,3-oxazol-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 23374801 |
| Molecular Formula | C13H14F3NO6S2 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | [5-(4-methylsulfonylphenyl)-2-(trifluoromethyl)-4,5-dihydro-1,3-oxazol-4-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC1N=C(C(F)(F)F)OC1c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H14F3NO6S2/c1-24(18,19)9-5-3-8(4-6-9)11-10(7-22-25(2,20)21)17-12(23-11)13(14,15)16/h3-6,10-11H,7H2,1-2H3 |
| InChIKey | GTYHLVWBVLFEPD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 99.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|