C6H6N4S — CID 2337481
[1,3]thiazolo[4,5-b]pyridine-2,5-diamine (PubChem CID 2337481) has the molecular formula C6H6N4S and a molecular weight of 166.21 g/mol. Its IUPAC name is [1,3]thiazolo[4,5-b]pyridine-2,5-diamine.
| Compound Name | [1,3]thiazolo[4,5-b]pyridine-2,5-diamine |
|---|---|
| PubChem CID | 2337481 |
| Molecular Formula | C6H6N4S |
| Molecular Weight | 166.21 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | [1,3]thiazolo[4,5-b]pyridine-2,5-diamine |
| SMILES | Nc1ccc2sc(N)nc2n1 |
| InChI | InChI=1S/C6H6N4S/c7-4-2-1-3-5(9-4)10-6(8)11-3/h1-2H,(H4,7,8,9,10) |
| InChIKey | OUQVIBJBPCRCAT-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.21 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |