About ethenyl 2-aminopropanoate
ethenyl 2-aminopropanoate (PubChem CID 23374910) has the molecular formula C5H9NO2
and a molecular weight of 115.13 g/mol. Its IUPAC name is ethenyl 2-aminopropanoate.
Molecular Properties
| Compound Name | ethenyl 2-aminopropanoate |
| PubChem CID | 23374910 |
| Molecular Formula | C5H9NO2 |
| Molecular Weight | 115.13 g/mol |
| Exact Mass | 115.06 |
| IUPAC Name | ethenyl 2-aminopropanoate |
| SMILES | C=COC(=O)C(C)N |
| InChI | InChI=1S/C5H9NO2/c1-3-8-5(7)4(2)6/h3-4H,1,6H2,2H3 |
| InChIKey | CGEZKNASTXJNKC-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.13 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethenyl 2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl 2-aminopropanoate?
The IUPAC name of ethenyl 2-aminopropanoate (CID 23374910) is ethenyl 2-aminopropanoate.
What is the SMILES notation for ethenyl 2-aminopropanoate?
The canonical SMILES for ethenyl 2-aminopropanoate is C=COC(=O)C(C)N.
What is the InChIKey of ethenyl 2-aminopropanoate?
The InChIKey is CGEZKNASTXJNKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2/c1-3-8-5(7)4(2)6/h3-4H,1,6H2,2H3.
What are the key properties of ethenyl 2-aminopropanoate?
ethenyl 2-aminopropanoate has a molecular weight of 115.13 g/mol, XLogP of 0.02, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl 2-aminopropanoate is sourced from PubChem (CID 23374910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).