About 3,5-ditert-butyl-N,N-bis(2-hydroxyethyl)benzamide
3,5-ditert-butyl-N,N-bis(2-hydroxyethyl)benzamide (PubChem CID 2337501) has the molecular formula C19H31NO3
and a molecular weight of 321.46 g/mol. Its IUPAC name is 3,5-ditert-butyl-N,N-bis(2-hydroxyethyl)benzamide.
Molecular Properties
| Compound Name | 3,5-ditert-butyl-N,N-bis(2-hydroxyethyl)benzamide |
| PubChem CID | 2337501 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | 3,5-ditert-butyl-N,N-bis(2-hydroxyethyl)benzamide |
| SMILES | CC(C)(C)c1cc(C(=O)N(CCO)CCO)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H31NO3/c1-18(2,3)15-11-14(12-16(13-15)19(4,5)6)17(23)20(7-9-21)8-10-22/h11-13,21-22H,7-10H2,1-6H3 |
| InChIKey | GDGAFQQYAWYWCM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-ditert-butyl-N,N-bis(2-hydroxyethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-ditert-butyl-N,N-bis(2-hydroxyethyl)benzamide?
The IUPAC name of 3,5-ditert-butyl-N,N-bis(2-hydroxyethyl)benzamide (CID 2337501) is 3,5-ditert-butyl-N,N-bis(2-hydroxyethyl)benzamide.
What is the SMILES notation for 3,5-ditert-butyl-N,N-bis(2-hydroxyethyl)benzamide?
The canonical SMILES for 3,5-ditert-butyl-N,N-bis(2-hydroxyethyl)benzamide is CC(C)(C)c1cc(C(=O)N(CCO)CCO)cc(C(C)(C)C)c1.
What is the InChIKey of 3,5-ditert-butyl-N,N-bis(2-hydroxyethyl)benzamide?
The InChIKey is GDGAFQQYAWYWCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31NO3/c1-18(2,3)15-11-14(12-16(13-15)19(4,5)6)17(23)20(7-9-21)8-10-22/h11-13,21-22H,7-10H2,1-6H3.
What are the key properties of 3,5-ditert-butyl-N,N-bis(2-hydroxyethyl)benzamide?
3,5-ditert-butyl-N,N-bis(2-hydroxyethyl)benzamide has a molecular weight of 321.46 g/mol, XLogP of 2.71, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-ditert-butyl-N,N-bis(2-hydroxyethyl)benzamide is sourced from PubChem (CID 2337501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).