C11H17N3O3 — CID 23375547
(1R,3S,6S,7R)-6,7-dimethyl-4-nitro-4-azatricyclo[4.3.0.03,7]nonane-3-carboxamide (PubChem CID 23375547) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is (1R,3S,6S,7R)-6,7-dimethyl-4-nitro-4-azatricyclo[4.3.0.03,7]nonane-3-carboxamide.
| Compound Name | (1R,3S,6S,7R)-6,7-dimethyl-4-nitro-4-azatricyclo[4.3.0.03,7]nonane-3-carboxamide |
|---|---|
| PubChem CID | 23375547 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | (1R,3S,6S,7R)-6,7-dimethyl-4-nitro-4-azatricyclo[4.3.0.03,7]nonane-3-carboxamide |
| SMILES | C[C@]12CC[C@@H]3C[C@]1(C(N)=O)N([N+](=O)[O-])C[C@@]32C |
| InChI | InChI=1S/C11H17N3O3/c1-9-6-13(14(16)17)11(8(12)15)5-7(9)3-4-10(9,11)2/h7H,3-6H2,1-2H3,(H2,12,15)/t7-,9+,10-,11-/m1/s1 |
| InChIKey | UWJNPVCWVBHAMS-APHKKCJPSA-N |
| XLogP | 0.54 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|