C18H17ClO5 — CID 23377032
(9E,11E)-16-chloro-19-hydroxy-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(19),9,11,15,17-pentaene-2,13-dione (PubChem CID 23377032) has the molecular formula C18H17ClO5 and a molecular weight of 348.78 g/mol. Its IUPAC name is (9E,11E)-16-chloro-19-hydroxy-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(19),9,11,15,17-pentaene-2,13-dione.
| Compound Name | (9E,11E)-16-chloro-19-hydroxy-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(19),9,11,15,17-pentaene-2,13-dione |
|---|---|
| PubChem CID | 23377032 |
| Molecular Formula | C18H17ClO5 |
| Molecular Weight | 348.78 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | (9E,11E)-16-chloro-19-hydroxy-4-methyl-3,7-dioxatricyclo[13.4.0.06,8]nonadeca-1(19),9,11,15,17-pentaene-2,13-dione |
| SMILES | CC1CC2OC2/C=C/C=C/C(=O)Cc2c(Cl)ccc(O)c2C(=O)O1 |
| InChI | InChI=1S/C18H17ClO5/c1-10-8-16-15(24-16)5-3-2-4-11(20)9-12-13(19)6-7-14(21)17(12)18(22)23-10/h2-7,10,15-16,21H,8-9H2,1H3/b4-2+,5-3+ |
| InChIKey | XPGZAUSAWFQOON-ZUVMSYQZSA-N |
| XLogP | 2.99 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.78 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|