C12H15FN2 — CID 2337750
N-(4-fluorophenyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine (PubChem CID 2337750) has the molecular formula C12H15FN2 and a molecular weight of 206.26 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine.
| Compound Name | N-(4-fluorophenyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine |
|---|---|
| PubChem CID | 2337750 |
| Molecular Formula | C12H15FN2 |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | N-(4-fluorophenyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine |
| SMILES | Fc1ccc(NC2=NCCCCC2)cc1 |
| InChI | InChI=1S/C12H15FN2/c13-10-5-7-11(8-6-10)15-12-4-2-1-3-9-14-12/h5-8H,1-4,9H2,(H,14,15) |
| InChIKey | HQQPCUYSAJKZQA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |