C11H12N2O5S — CID 23377736
(3R)-4-oxo-3-(1,3-thiazol-4-ylmethyl)piperidine-1,3-dicarboxylic acid (PubChem CID 23377736) has the molecular formula C11H12N2O5S and a molecular weight of 284.29 g/mol. Its IUPAC name is (3R)-4-oxo-3-(1,3-thiazol-4-ylmethyl)piperidine-1,3-dicarboxylic acid.
| Compound Name | (3R)-4-oxo-3-(1,3-thiazol-4-ylmethyl)piperidine-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 23377736 |
| Molecular Formula | C11H12N2O5S |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | (3R)-4-oxo-3-(1,3-thiazol-4-ylmethyl)piperidine-1,3-dicarboxylic acid |
| SMILES | O=C(O)N1CCC(=O)[C@](Cc2cscn2)(C(=O)O)C1 |
| InChI | InChI=1S/C11H12N2O5S/c14-8-1-2-13(10(17)18)5-11(8,9(15)16)3-7-4-19-6-12-7/h4,6H,1-3,5H2,(H,15,16)(H,17,18)/t11-/m1/s1 |
| InChIKey | SMXRAXPAPXSCGV-LLVKDONJSA-N |
| XLogP | 0.71 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|