About 1-oxidopiperidine-3,4,5-triol
1-oxidopiperidine-3,4,5-triol (PubChem CID 23377778) has the molecular formula C5H10NO4-
and a molecular weight of 148.14 g/mol. Its IUPAC name is 1-oxidopiperidine-3,4,5-triol.
Molecular Properties
| Compound Name | 1-oxidopiperidine-3,4,5-triol |
| PubChem CID | 23377778 |
| Molecular Formula | C5H10NO4- |
| Molecular Weight | 148.14 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 1-oxidopiperidine-3,4,5-triol |
| SMILES | [O-]N1CC(O)C(O)C(O)C1 |
| InChI | InChI=1S/C5H10NO4/c7-3-1-6(10)2-4(8)5(3)9/h3-5,7-9H,1-2H2/q-1 |
| InChIKey | LBMJIZBZMVIZAV-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.14 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-oxidopiperidine-3,4,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxidopiperidine-3,4,5-triol?
The IUPAC name of 1-oxidopiperidine-3,4,5-triol (CID 23377778) is 1-oxidopiperidine-3,4,5-triol.
What is the SMILES notation for 1-oxidopiperidine-3,4,5-triol?
The canonical SMILES for 1-oxidopiperidine-3,4,5-triol is [O-]N1CC(O)C(O)C(O)C1.
What is the InChIKey of 1-oxidopiperidine-3,4,5-triol?
The InChIKey is LBMJIZBZMVIZAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10NO4/c7-3-1-6(10)2-4(8)5(3)9/h3-5,7-9H,1-2H2/q-1.
What are the key properties of 1-oxidopiperidine-3,4,5-triol?
1-oxidopiperidine-3,4,5-triol has a molecular weight of 148.14 g/mol, XLogP of -2.12, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxidopiperidine-3,4,5-triol is sourced from PubChem (CID 23377778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).