About [3-nitrooxy-1,4-bis[(1-oxidopiperidin-1-ium-4-yl)oxy]butan-2-yl] nitrate
[3-nitrooxy-1,4-bis[(1-oxidopiperidin-1-ium-4-yl)oxy]butan-2-yl] nitrate (PubChem CID 23377783) has the molecular formula C14H26N4O10
and a molecular weight of 410.38 g/mol. Its IUPAC name is [3-nitrooxy-1,4-bis[(1-oxidopiperidin-1-ium-4-yl)oxy]butan-2-yl] nitrate.
Molecular Properties
| Compound Name | [3-nitrooxy-1,4-bis[(1-oxidopiperidin-1-ium-4-yl)oxy]butan-2-yl] nitrate |
| PubChem CID | 23377783 |
| Molecular Formula | C14H26N4O10 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | [3-nitrooxy-1,4-bis[(1-oxidopiperidin-1-ium-4-yl)oxy]butan-2-yl] nitrate |
| SMILES | O=[N+]([O-])OC(COC1CC[NH+]([O-])CC1)C(COC1CC[NH+]([O-])CC1)O[N+](=O)[O-] |
| InChI | InChI=1S/C14H26N4O10/c19-15-5-1-11(2-6-15)25-9-13(27-17(21)22)14(28-18(23)24)10-26-12-3-7-16(20)8-4-12/h11-16H,1-10H2 |
| InChIKey | GEBPERXJTLWZEW-UHFFFAOYSA-N |
| XLogP | -2.74 |
| TPSA | 178.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-nitrooxy-1,4-bis[(1-oxidopiperidin-1-ium-4-yl)oxy]butan-2-yl] nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-nitrooxy-1,4-bis[(1-oxidopiperidin-1-ium-4-yl)oxy]butan-2-yl] nitrate?
The IUPAC name of [3-nitrooxy-1,4-bis[(1-oxidopiperidin-1-ium-4-yl)oxy]butan-2-yl] nitrate (CID 23377783) is [3-nitrooxy-1,4-bis[(1-oxidopiperidin-1-ium-4-yl)oxy]butan-2-yl] nitrate.
What is the SMILES notation for [3-nitrooxy-1,4-bis[(1-oxidopiperidin-1-ium-4-yl)oxy]butan-2-yl] nitrate?
The canonical SMILES for [3-nitrooxy-1,4-bis[(1-oxidopiperidin-1-ium-4-yl)oxy]butan-2-yl] nitrate is O=[N+]([O-])OC(COC1CC[NH+]([O-])CC1)C(COC1CC[NH+]([O-])CC1)O[N+](=O)[O-].
What is the InChIKey of [3-nitrooxy-1,4-bis[(1-oxidopiperidin-1-ium-4-yl)oxy]butan-2-yl] nitrate?
The InChIKey is GEBPERXJTLWZEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N4O10/c19-15-5-1-11(2-6-15)25-9-13(27-17(21)22)14(28-18(23)24)10-26-12-3-7-16(20)8-4-12/h11-16H,1-10H2.
What are the key properties of [3-nitrooxy-1,4-bis[(1-oxidopiperidin-1-ium-4-yl)oxy]butan-2-yl] nitrate?
[3-nitrooxy-1,4-bis[(1-oxidopiperidin-1-ium-4-yl)oxy]butan-2-yl] nitrate has a molecular weight of 410.38 g/mol, XLogP of -2.74, 11 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for [3-nitrooxy-1,4-bis[(1-oxidopiperidin-1-ium-4-yl)oxy]butan-2-yl] nitrate is sourced from PubChem (CID 23377783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).