[1-nitrooxy-3-(1-oxidopiperidin-4-yl)oxypropan-2-yl] nitrate

C8H14N3O8- — CID 23377786

IUPAC[1-nitrooxy-3-(1-oxidopiperidin-4-yl)oxypropan-2-yl] nitrate
SMILESO=[N+]([O-])OCC(COC1CCN([O-])CC1)O[N+](=O)[O-]
InChIInChI=1S/C8H14N3O8/c12-9-3-1-7(2-4-9)17-5-8(19-11(15)16)6-18-10(13)14/h7-8H,1-6H2/q-1
InChIKeyOEGQOZVYLFODEH-UHFFFAOYSA-N
MW280.21 g/mol
LogP-0.25
Rot. Bonds8

About [1-nitrooxy-3-(1-oxidopiperidin-4-yl)oxypropan-2-yl] nitrate

[1-nitrooxy-3-(1-oxidopiperidin-4-yl)oxypropan-2-yl] nitrate (PubChem CID 23377786) has the molecular formula C8H14N3O8- and a molecular weight of 280.21 g/mol. Its IUPAC name is [1-nitrooxy-3-(1-oxidopiperidin-4-yl)oxypropan-2-yl] nitrate.

Molecular Properties

Compound Name[1-nitrooxy-3-(1-oxidopiperidin-4-yl)oxypropan-2-yl] nitrate
PubChem CID23377786
Molecular FormulaC8H14N3O8-
Molecular Weight280.21 g/mol
Exact Mass280.08
IUPAC Name[1-nitrooxy-3-(1-oxidopiperidin-4-yl)oxypropan-2-yl] nitrate
SMILESO=[N+]([O-])OCC(COC1CCN([O-])CC1)O[N+](=O)[O-]
InChIInChI=1S/C8H14N3O8/c12-9-3-1-7(2-4-9)17-5-8(19-11(15)16)6-18-10(13)14/h7-8H,1-6H2/q-1
InChIKeyOEGQOZVYLFODEH-UHFFFAOYSA-N
XLogP-0.25
TPSA140.27 Ų
H-Bond Donors
H-Bond Acceptors9
Rotatable Bonds8
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.21
LogP ≤ 5-0.25
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 109

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze [1-nitrooxy-3-(1-oxidopiperidin-4-yl)oxypropan-2-yl] nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [1-nitrooxy-3-(1-oxidopiperidin-4-yl)oxypropan-2-yl] nitrate?
The IUPAC name of [1-nitrooxy-3-(1-oxidopiperidin-4-yl)oxypropan-2-yl] nitrate (CID 23377786) is [1-nitrooxy-3-(1-oxidopiperidin-4-yl)oxypropan-2-yl] nitrate.
What is the SMILES notation for [1-nitrooxy-3-(1-oxidopiperidin-4-yl)oxypropan-2-yl] nitrate?
The canonical SMILES for [1-nitrooxy-3-(1-oxidopiperidin-4-yl)oxypropan-2-yl] nitrate is O=[N+]([O-])OCC(COC1CCN([O-])CC1)O[N+](=O)[O-].
What is the InChIKey of [1-nitrooxy-3-(1-oxidopiperidin-4-yl)oxypropan-2-yl] nitrate?
The InChIKey is OEGQOZVYLFODEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N3O8/c12-9-3-1-7(2-4-9)17-5-8(19-11(15)16)6-18-10(13)14/h7-8H,1-6H2/q-1.
What are the key properties of [1-nitrooxy-3-(1-oxidopiperidin-4-yl)oxypropan-2-yl] nitrate?
[1-nitrooxy-3-(1-oxidopiperidin-4-yl)oxypropan-2-yl] nitrate has a molecular weight of 280.21 g/mol, XLogP of -0.25, 8 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [1-nitrooxy-3-(1-oxidopiperidin-4-yl)oxypropan-2-yl] nitrate is sourced from PubChem (CID 23377786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).