C16H25BrOSi — CID 23377895
(6-bromo-1,2,3,4-tetrahydronaphthalen-2-yl)oxy-tert-butyl-dimethylsilane (PubChem CID 23377895) has the molecular formula C16H25BrOSi and a molecular weight of 341.37 g/mol. Its IUPAC name is (6-bromo-1,2,3,4-tetrahydronaphthalen-2-yl)oxy-tert-butyl-dimethylsilane.
| Compound Name | (6-bromo-1,2,3,4-tetrahydronaphthalen-2-yl)oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 23377895 |
| Molecular Formula | C16H25BrOSi |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | (6-bromo-1,2,3,4-tetrahydronaphthalen-2-yl)oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCc2cc(Br)ccc2C1 |
| InChI | InChI=1S/C16H25BrOSi/c1-16(2,3)19(4,5)18-15-9-7-12-10-14(17)8-6-13(12)11-15/h6,8,10,15H,7,9,11H2,1-5H3 |
| InChIKey | RRLPPFMONZTMSD-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|