C8H16Cl2N2O6P2 — CID 2337856
N,N'-bis[chloromethyl(ethoxy)phosphoryl]oxamide (PubChem CID 2337856) has the molecular formula C8H16Cl2N2O6P2 and a molecular weight of 369.08 g/mol. Its IUPAC name is N,N'-bis[chloromethyl(ethoxy)phosphoryl]oxamide.
| Compound Name | N,N'-bis[chloromethyl(ethoxy)phosphoryl]oxamide |
|---|---|
| PubChem CID | 2337856 |
| Molecular Formula | C8H16Cl2N2O6P2 |
| Molecular Weight | 369.08 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | N,N'-bis[chloromethyl(ethoxy)phosphoryl]oxamide |
| SMILES | CCOP(=O)(CCl)NC(=O)C(=O)NP(=O)(CCl)OCC |
| InChI | InChI=1S/C8H16Cl2N2O6P2/c1-3-17-19(15,5-9)11-7(13)8(14)12-20(16,6-10)18-4-2/h3-6H2,1-2H3,(H,11,13,15)(H,12,14,16) |
| InChIKey | MFDGZQYRJWBVDP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.08 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|