C20H18ClNOS — CID 2337968
2-(2-chlorophenyl)sulfanyl-N-ethyl-N-naphthalen-1-ylacetamide (PubChem CID 2337968) has the molecular formula C20H18ClNOS and a molecular weight of 355.89 g/mol. Its IUPAC name is 2-(2-chlorophenyl)sulfanyl-N-ethyl-N-naphthalen-1-ylacetamide.
| Compound Name | 2-(2-chlorophenyl)sulfanyl-N-ethyl-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 2337968 |
| Molecular Formula | C20H18ClNOS |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 2-(2-chlorophenyl)sulfanyl-N-ethyl-N-naphthalen-1-ylacetamide |
| SMILES | CCN(C(=O)CSc1ccccc1Cl)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H18ClNOS/c1-2-22(18-12-7-9-15-8-3-4-10-16(15)18)20(23)14-24-19-13-6-5-11-17(19)21/h3-13H,2,14H2,1H3 |
| InChIKey | JEMNEHNELKMOEU-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |