C11H16N3+ — CID 23380172
2-cyclohexyl-3H-pyrrolo[2,1-c][1,2,4]triazol-2-ium (PubChem CID 23380172) has the molecular formula C11H16N3+ and a molecular weight of 190.27 g/mol. Its IUPAC name is 2-cyclohexyl-3H-pyrrolo[2,1-c][1,2,4]triazol-2-ium.
| Compound Name | 2-cyclohexyl-3H-pyrrolo[2,1-c][1,2,4]triazol-2-ium |
|---|---|
| PubChem CID | 23380172 |
| Molecular Formula | C11H16N3+ |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | 2-cyclohexyl-3H-pyrrolo[2,1-c][1,2,4]triazol-2-ium |
| SMILES | c1cc2n(c1)C[N+](C1CCCCC1)=N2 |
| InChI | InChI=1S/C11H16N3/c1-2-5-10(6-3-1)14-9-13-8-4-7-11(13)12-14/h4,7-8,10H,1-3,5-6,9H2/q+1 |
| InChIKey | JGZOYMLDNJFSEQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 20.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|