About trimethyl-(2-phenyl-3H-phospholo[1,2-c][1,3]azaphosphol-2-ium-5-yl)silane
trimethyl-(2-phenyl-3H-phospholo[1,2-c][1,3]azaphosphol-2-ium-5-yl)silane (PubChem CID 23380266) has the molecular formula C15H19NPSi+
and a molecular weight of 272.38 g/mol. Its IUPAC name is trimethyl-(2-phenyl-3H-phospholo[1,2-c][1,3]azaphosphol-2-ium-5-yl)silane.
Molecular Properties
| Compound Name | trimethyl-(2-phenyl-3H-phospholo[1,2-c][1,3]azaphosphol-2-ium-5-yl)silane |
| PubChem CID | 23380266 |
| Molecular Formula | C15H19NPSi+ |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | trimethyl-(2-phenyl-3H-phospholo[1,2-c][1,3]azaphosphol-2-ium-5-yl)silane |
| SMILES | C[Si](C)(C)c1ccc2p1C[N+](c1ccccc1)=C2 |
| InChI | InChI=1S/C15H19NPSi/c1-18(2,3)15-10-9-14-11-16(12-17(14)15)13-7-5-4-6-8-13/h4-11H,12H2,1-3H3/q+1 |
| InChIKey | HASPVMOKPKSOIR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-(2-phenyl-3H-phospholo[1,2-c][1,3]azaphosphol-2-ium-5-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-(2-phenyl-3H-phospholo[1,2-c][1,3]azaphosphol-2-ium-5-yl)silane?
The IUPAC name of trimethyl-(2-phenyl-3H-phospholo[1,2-c][1,3]azaphosphol-2-ium-5-yl)silane (CID 23380266) is trimethyl-(2-phenyl-3H-phospholo[1,2-c][1,3]azaphosphol-2-ium-5-yl)silane.
What is the SMILES notation for trimethyl-(2-phenyl-3H-phospholo[1,2-c][1,3]azaphosphol-2-ium-5-yl)silane?
The canonical SMILES for trimethyl-(2-phenyl-3H-phospholo[1,2-c][1,3]azaphosphol-2-ium-5-yl)silane is C[Si](C)(C)c1ccc2p1C[N+](c1ccccc1)=C2.
What is the InChIKey of trimethyl-(2-phenyl-3H-phospholo[1,2-c][1,3]azaphosphol-2-ium-5-yl)silane?
The InChIKey is HASPVMOKPKSOIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NPSi/c1-18(2,3)15-10-9-14-11-16(12-17(14)15)13-7-5-4-6-8-13/h4-11H,12H2,1-3H3/q+1.
What are the key properties of trimethyl-(2-phenyl-3H-phospholo[1,2-c][1,3]azaphosphol-2-ium-5-yl)silane?
trimethyl-(2-phenyl-3H-phospholo[1,2-c][1,3]azaphosphol-2-ium-5-yl)silane has a molecular weight of 272.38 g/mol, XLogP of 3.95, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-(2-phenyl-3H-phospholo[1,2-c][1,3]azaphosphol-2-ium-5-yl)silane is sourced from PubChem (CID 23380266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).