About (E)-2-[[2-(dimethylamino)-3-methylbutanoyl]-methylamino]-3-hydroxy-N,4-dimethyloct-6-enamide
(E)-2-[[2-(dimethylamino)-3-methylbutanoyl]-methylamino]-3-hydroxy-N,4-dimethyloct-6-enamide (PubChem CID 23380484) has the molecular formula C18H35N3O3
and a molecular weight of 341.50 g/mol. Its IUPAC name is (E)-2-[[2-(dimethylamino)-3-methylbutanoyl]-methylamino]-3-hydroxy-N,4-dimethyloct-6-enamide.
Molecular Properties
| Compound Name | (E)-2-[[2-(dimethylamino)-3-methylbutanoyl]-methylamino]-3-hydroxy-N,4-dimethyloct-6-enamide |
| PubChem CID | 23380484 |
| Molecular Formula | C18H35N3O3 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.27 |
| IUPAC Name | (E)-2-[[2-(dimethylamino)-3-methylbutanoyl]-methylamino]-3-hydroxy-N,4-dimethyloct-6-enamide |
| SMILES | C/C=C/CC(C)C(O)C(C(=O)NC)N(C)C(=O)C(C(C)C)N(C)C |
| InChI | InChI=1S/C18H35N3O3/c1-9-10-11-13(4)16(22)15(17(23)19-5)21(8)18(24)14(12(2)3)20(6)7/h9-10,12-16,22H,11H2,1-8H3,(H,19,23)/b10-9+ |
| InChIKey | MXTMNFZELVUWQV-MDZDMXLPSA-N |
| XLogP | 1.11 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-[[2-(dimethylamino)-3-methylbutanoyl]-methylamino]-3-hydroxy-N,4-dimethyloct-6-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-[[2-(dimethylamino)-3-methylbutanoyl]-methylamino]-3-hydroxy-N,4-dimethyloct-6-enamide?
The IUPAC name of (E)-2-[[2-(dimethylamino)-3-methylbutanoyl]-methylamino]-3-hydroxy-N,4-dimethyloct-6-enamide (CID 23380484) is (E)-2-[[2-(dimethylamino)-3-methylbutanoyl]-methylamino]-3-hydroxy-N,4-dimethyloct-6-enamide.
What is the SMILES notation for (E)-2-[[2-(dimethylamino)-3-methylbutanoyl]-methylamino]-3-hydroxy-N,4-dimethyloct-6-enamide?
The canonical SMILES for (E)-2-[[2-(dimethylamino)-3-methylbutanoyl]-methylamino]-3-hydroxy-N,4-dimethyloct-6-enamide is C/C=C/CC(C)C(O)C(C(=O)NC)N(C)C(=O)C(C(C)C)N(C)C.
What is the InChIKey of (E)-2-[[2-(dimethylamino)-3-methylbutanoyl]-methylamino]-3-hydroxy-N,4-dimethyloct-6-enamide?
The InChIKey is MXTMNFZELVUWQV-MDZDMXLPSA-N. The full InChI is InChI=1S/C18H35N3O3/c1-9-10-11-13(4)16(22)15(17(23)19-5)21(8)18(24)14(12(2)3)20(6)7/h9-10,12-16,22H,11H2,1-8H3,(H,19,23)/b10-9+.
What are the key properties of (E)-2-[[2-(dimethylamino)-3-methylbutanoyl]-methylamino]-3-hydroxy-N,4-dimethyloct-6-enamide?
(E)-2-[[2-(dimethylamino)-3-methylbutanoyl]-methylamino]-3-hydroxy-N,4-dimethyloct-6-enamide has a molecular weight of 341.50 g/mol, XLogP of 1.11, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-[[2-(dimethylamino)-3-methylbutanoyl]-methylamino]-3-hydroxy-N,4-dimethyloct-6-enamide is sourced from PubChem (CID 23380484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).